C26H22Cl2N2O3 — CID 5234591
3-(3,5-dichloro-2-methoxyphenyl)-N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]prop-2-enamide (PubChem CID 5234591) has the molecular formula C26H22Cl2N2O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is 3-(3,5-dichloro-2-methoxyphenyl)-N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]prop-2-enamide.
| Compound Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 5234591 |
| Molecular Formula | C26H22Cl2N2O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 3-(3,5-dichloro-2-methoxyphenyl)-N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1cccc(-c2nc3cc(C)cc(C)c3o2)c1C |
| InChI | InChI=1S/C26H22Cl2N2O3/c1-14-10-15(2)24-22(11-14)30-26(33-24)19-6-5-7-21(16(19)3)29-23(31)9-8-17-12-18(27)13-20(28)25(17)32-4/h5-13H,1-4H3,(H,29,31) |
| InChIKey | ZAXXGARMFDNERR-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|