C27H20Cl2N4O2 — CID 2067775
(E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)prop-2-enamide (PubChem CID 2067775) has the molecular formula C27H20Cl2N4O2 and a molecular weight of 503.39 g/mol. Its IUPAC name is (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2067775 |
| Molecular Formula | C27H20Cl2N4O2 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1/C=C/C(=O)Nc1cc2nn(-c3cccc4ccccc34)nc2cc1C |
| InChI | InChI=1S/C27H20Cl2N4O2/c1-16-12-23-24(32-33(31-23)25-9-5-7-17-6-3-4-8-20(17)25)15-22(16)30-26(34)11-10-18-13-19(28)14-21(29)27(18)35-2/h3-15H,1-2H3,(H,30,34)/b11-10+ |
| InChIKey | XHQLKUMSRJYMOR-ZHACJKMWSA-N |
| XLogP | 6.85 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|