C26H18ClN5O3 — CID 23098313
(E)-3-(4-chloro-3-nitrophenyl)-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)prop-2-enamide (PubChem CID 23098313) has the molecular formula C26H18ClN5O3 and a molecular weight of 483.92 g/mol. Its IUPAC name is (E)-3-(4-chloro-3-nitrophenyl)-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-chloro-3-nitrophenyl)-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 23098313 |
| Molecular Formula | C26H18ClN5O3 |
| Molecular Weight | 483.92 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | (E)-3-(4-chloro-3-nitrophenyl)-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)prop-2-enamide |
| SMILES | Cc1cc2nn(-c3cccc4ccccc34)nc2cc1NC(=O)/C=C/c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H18ClN5O3/c1-16-13-22-23(30-31(29-22)24-8-4-6-18-5-2-3-7-19(18)24)15-21(16)28-26(33)12-10-17-9-11-20(27)25(14-17)32(34)35/h2-15H,1H3,(H,28,33)/b12-10+ |
| InChIKey | MFVNTHSCFJNLHU-ZRDIBKRKSA-N |
| XLogP | 6.10 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.92 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|