C25H18ClN5OS — CID 23096867
4-chloro-N-[(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)carbamothioyl]benzamide (PubChem CID 23096867) has the molecular formula C25H18ClN5OS and a molecular weight of 471.97 g/mol. Its IUPAC name is 4-chloro-N-[(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 4-chloro-N-[(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 23096867 |
| Molecular Formula | C25H18ClN5OS |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 4-chloro-N-[(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)carbamothioyl]benzamide |
| SMILES | Cc1cc2nn(-c3cccc4ccccc34)nc2cc1NC(=S)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18ClN5OS/c1-15-13-21-22(30-31(29-21)23-8-4-6-16-5-2-3-7-19(16)23)14-20(15)27-25(33)28-24(32)17-9-11-18(26)12-10-17/h2-14H,1H3,(H2,27,28,32,33) |
| InChIKey | CYGJDTAMKRSVEB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|