C25H25N5O2S — CID 17104704
4-methoxy-N-[[6-methyl-2-(4-propan-2-ylphenyl)benzotriazol-5-yl]carbamothioyl]benzamide (PubChem CID 17104704) has the molecular formula C25H25N5O2S and a molecular weight of 459.58 g/mol. Its IUPAC name is 4-methoxy-N-[[6-methyl-2-(4-propan-2-ylphenyl)benzotriazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 4-methoxy-N-[[6-methyl-2-(4-propan-2-ylphenyl)benzotriazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17104704 |
| Molecular Formula | C25H25N5O2S |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-methoxy-N-[[6-methyl-2-(4-propan-2-ylphenyl)benzotriazol-5-yl]carbamothioyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cc3nn(-c4ccc(C(C)C)cc4)nc3cc2C)cc1 |
| InChI | InChI=1S/C25H25N5O2S/c1-15(2)17-5-9-19(10-6-17)30-28-22-13-16(3)21(14-23(22)29-30)26-25(33)27-24(31)18-7-11-20(32-4)12-8-18/h5-15H,1-4H3,(H2,26,27,31,33) |
| InChIKey | QQHWJGCGOHWBQD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|