C23H22N4O2 — CID 1316133
N-[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]-3,4-dimethylbenzamide (PubChem CID 1316133) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 1316133 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]-3,4-dimethylbenzamide |
| SMILES | COc1ccc(-n2nc3cc(C)c(NC(=O)c4ccc(C)c(C)c4)cc3n2)cc1 |
| InChI | InChI=1S/C23H22N4O2/c1-14-5-6-17(11-15(14)2)23(28)24-20-13-22-21(12-16(20)3)25-27(26-22)18-7-9-19(29-4)10-8-18/h5-13H,1-4H3,(H,24,28) |
| InChIKey | GICMYKYJNLAYRD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |