C25H26N4O4 — CID 1365245
3,5-diethoxy-N-[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]benzamide (PubChem CID 1365245) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 3,5-diethoxy-N-[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]benzamide.
| Compound Name | 3,5-diethoxy-N-[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]benzamide |
|---|---|
| PubChem CID | 1365245 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3,5-diethoxy-N-[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]benzamide |
| SMILES | CCOc1cc(OCC)cc(C(=O)Nc2cc3nn(-c4ccc(OC)cc4)nc3cc2C)c1 |
| InChI | InChI=1S/C25H26N4O4/c1-5-32-20-12-17(13-21(14-20)33-6-2)25(30)26-22-15-24-23(11-16(22)3)27-29(28-24)18-7-9-19(31-4)10-8-18/h7-15H,5-6H2,1-4H3,(H,26,30) |
| InChIKey | VGHNVHJXJBBESD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |