C25H25N5O3S — CID 1345438
3-ethoxy-N-[[2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide (PubChem CID 1345438) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is 3-ethoxy-N-[[2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 3-ethoxy-N-[[2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1345438 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 3-ethoxy-N-[[2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)c4cccc(OCC)c4)cc3n2)cc1 |
| InChI | InChI=1S/C25H25N5O3S/c1-4-32-19-11-9-18(10-12-19)30-28-22-13-16(3)21(15-23(22)29-30)26-25(34)27-24(31)17-7-6-8-20(14-17)33-5-2/h6-15H,4-5H2,1-3H3,(H2,26,27,31,34) |
| InChIKey | RLFMJTQQOGOPQG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|