C25H19ClN4OS — CID 23095277
2-(4-chlorophenyl)sulfanyl-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)acetamide (PubChem CID 23095277) has the molecular formula C25H19ClN4OS and a molecular weight of 458.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)acetamide |
|---|---|
| PubChem CID | 23095277 |
| Molecular Formula | C25H19ClN4OS |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(6-methyl-2-naphthalen-1-ylbenzotriazol-5-yl)acetamide |
| SMILES | Cc1cc2nn(-c3cccc4ccccc34)nc2cc1NC(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19ClN4OS/c1-16-13-22-23(14-21(16)27-25(31)15-32-19-11-9-18(26)10-12-19)29-30(28-22)24-8-4-6-17-5-2-3-7-20(17)24/h2-14H,15H2,1H3,(H,27,31) |
| InChIKey | VEXBRZVGTGOBIH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |