C23H18Cl2N4O2 — CID 1395089
(E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(6-methyl-2-phenylbenzotriazol-5-yl)prop-2-enamide (PubChem CID 1395089) has the molecular formula C23H18Cl2N4O2 and a molecular weight of 453.33 g/mol. Its IUPAC name is (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(6-methyl-2-phenylbenzotriazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(6-methyl-2-phenylbenzotriazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1395089 |
| Molecular Formula | C23H18Cl2N4O2 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(6-methyl-2-phenylbenzotriazol-5-yl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1/C=C/C(=O)Nc1cc2nn(-c3ccccc3)nc2cc1C |
| InChI | InChI=1S/C23H18Cl2N4O2/c1-14-10-20-21(28-29(27-20)17-6-4-3-5-7-17)13-19(14)26-22(30)9-8-15-11-16(24)12-18(25)23(15)31-2/h3-13H,1-2H3,(H,26,30)/b9-8+ |
| InChIKey | BJICOCQELCUUNN-CMDGGOBGSA-N |
| XLogP | 5.70 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|