C24H17Cl3N2O3 — CID 4655937
N-[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide (PubChem CID 4655937) has the molecular formula C24H17Cl3N2O3 and a molecular weight of 487.77 g/mol. Its IUPAC name is N-[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4655937 |
| Molecular Formula | C24H17Cl3N2O3 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | N-[4-chloro-3-(6-methyl-1,3-benzoxazol-2-yl)phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1ccc(Cl)c(-c2nc3ccc(C)cc3o2)c1 |
| InChI | InChI=1S/C24H17Cl3N2O3/c1-13-3-7-20-21(9-13)32-24(29-20)17-12-16(5-6-18(17)26)28-22(30)8-4-14-10-15(25)11-19(27)23(14)31-2/h3-12H,1-2H3,(H,28,30) |
| InChIKey | HDVZGUHTCGLHFC-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|