C19H14Cl2N2O4 — CID 1397507
(E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide (PubChem CID 1397507) has the molecular formula C19H14Cl2N2O4 and a molecular weight of 405.24 g/mol. Its IUPAC name is (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1397507 |
| Molecular Formula | C19H14Cl2N2O4 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1/C=C/C(=O)Nc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C19H14Cl2N2O4/c1-23-18(25)13-5-4-12(9-14(13)19(23)26)22-16(24)6-3-10-7-11(20)8-15(21)17(10)27-2/h3-9H,1-2H3,(H,22,24)/b6-3+ |
| InChIKey | OEWYDFZFXSPUND-ZZXKWVIFSA-N |
| XLogP | 3.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|