C23H15Cl2FN2O3 — CID 6059021
(E)-3-(3,5-dichloro-2-methoxyphenyl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-enamide (PubChem CID 6059021) has the molecular formula C23H15Cl2FN2O3 and a molecular weight of 457.29 g/mol. Its IUPAC name is (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6059021 |
| Molecular Formula | C23H15Cl2FN2O3 |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | (E)-3-(3,5-dichloro-2-methoxyphenyl)-N-[2-(4-fluorophenyl)-1,3-benzoxazol-5-yl]prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1/C=C/C(=O)Nc1ccc2oc(-c3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C23H15Cl2FN2O3/c1-30-22-14(10-15(24)11-18(22)25)4-9-21(29)27-17-7-8-20-19(12-17)28-23(31-20)13-2-5-16(26)6-3-13/h2-12H,1H3,(H,27,29)/b9-4+ |
| InChIKey | IGEKUBRIUTWBCH-RUDMXATFSA-N |
| XLogP | 6.60 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|