C26H21Cl3N2O3 — CID 5137112
N-[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide (PubChem CID 5137112) has the molecular formula C26H21Cl3N2O3 and a molecular weight of 515.82 g/mol. Its IUPAC name is N-[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5137112 |
| Molecular Formula | C26H21Cl3N2O3 |
| Molecular Weight | 515.82 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | N-[2-chloro-5-(5-propan-2-yl-1,3-benzoxazol-2-yl)phenyl]-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1cc(-c2nc3cc(C(C)C)ccc3o2)ccc1Cl |
| InChI | InChI=1S/C26H21Cl3N2O3/c1-14(2)15-5-8-23-22(11-15)31-26(34-23)17-4-7-19(28)21(12-17)30-24(32)9-6-16-10-18(27)13-20(29)25(16)33-3/h4-14H,1-3H3,(H,30,32) |
| InChIKey | VGKKRHAPGYMMFK-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.82 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|