C24H18Cl2N2O2 — CID 6153578
(E)-3-(2,4-dichlorophenyl)-N-[2-(2,4-dimethylphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide (PubChem CID 6153578) has the molecular formula C24H18Cl2N2O2 and a molecular weight of 437.33 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[2-(2,4-dimethylphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[2-(2,4-dimethylphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6153578 |
| Molecular Formula | C24H18Cl2N2O2 |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[2-(2,4-dimethylphenyl)-1,3-benzoxazol-5-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2nc3cc(NC(=O)/C=C/c4ccc(Cl)cc4Cl)ccc3o2)c(C)c1 |
| InChI | InChI=1S/C24H18Cl2N2O2/c1-14-3-8-19(15(2)11-14)24-28-21-13-18(7-9-22(21)30-24)27-23(29)10-5-16-4-6-17(25)12-20(16)26/h3-13H,1-2H3,(H,27,29)/b10-5+ |
| InChIKey | PQMLWGKBTRIEBW-BJMVGYQFSA-N |
| XLogP | 7.07 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|