C26H15Cl3N2O2 — CID 17117145
(E)-N-[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 17117145) has the molecular formula C26H15Cl3N2O2 and a molecular weight of 493.78 g/mol. Its IUPAC name is (E)-N-[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17117145 |
| Molecular Formula | C26H15Cl3N2O2 |
| Molecular Weight | 493.78 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | (E)-N-[2-(5-chloronaphthalen-1-yl)-1,3-benzoxazol-5-yl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1ccc2oc(-c3cccc4c(Cl)cccc34)nc2c1 |
| InChI | InChI=1S/C26H15Cl3N2O2/c27-16-9-7-15(22(29)13-16)8-12-25(32)30-17-10-11-24-23(14-17)31-26(33-24)20-5-1-4-19-18(20)3-2-6-21(19)28/h1-14H,(H,30,32)/b12-8+ |
| InChIKey | LNXSNTWRXNCWQA-XYOKQWHBSA-N |
| XLogP | 8.26 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.78 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|