C22H14Cl2N2O2 — CID 3557316
N-[2-(2,3-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-phenylprop-2-enamide (PubChem CID 3557316) has the molecular formula C22H14Cl2N2O2 and a molecular weight of 409.27 g/mol. Its IUPAC name is N-[2-(2,3-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[2-(2,3-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 3557316 |
| Molecular Formula | C22H14Cl2N2O2 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | N-[2-(2,3-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1ccc2oc(-c3cccc(Cl)c3Cl)nc2c1 |
| InChI | InChI=1S/C22H14Cl2N2O2/c23-17-8-4-7-16(21(17)24)22-26-18-13-15(10-11-19(18)28-22)25-20(27)12-9-14-5-2-1-3-6-14/h1-13H,(H,25,27) |
| InChIKey | VLTZRKJEGGIZHK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|