C26H15Cl3N2O3 — CID 17117175
(E)-N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17117175) has the molecular formula C26H15Cl3N2O3 and a molecular weight of 509.78 g/mol. Its IUPAC name is (E)-N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17117175 |
| Molecular Formula | C26H15Cl3N2O3 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | (E)-N-[2-(2-chlorophenyl)-1,3-benzoxazol-5-yl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)Nc1ccc2oc(-c3ccccc3Cl)nc2c1 |
| InChI | InChI=1S/C26H15Cl3N2O3/c27-16-11-15(12-17(28)13-16)23-9-6-19(33-23)7-10-25(32)30-18-5-8-24-22(14-18)31-26(34-24)20-3-1-2-4-21(20)29/h1-14H,(H,30,32)/b10-7+ |
| InChIKey | MKCBNRHONUCKAD-JXMROGBWSA-N |
| XLogP | 8.37 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|