C26H14Cl4N2O3 — CID 17318879
(E)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17318879) has the molecular formula C26H14Cl4N2O3 and a molecular weight of 544.22 g/mol. Its IUPAC name is (E)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17318879 |
| Molecular Formula | C26H14Cl4N2O3 |
| Molecular Weight | 544.22 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | (E)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1)Nc1ccc2oc(-c3ccc(Cl)cc3Cl)nc2c1 |
| InChI | InChI=1S/C26H14Cl4N2O3/c27-14-1-6-18(20(29)11-14)23-9-4-17(34-23)5-10-25(33)31-16-3-8-24-22(13-16)32-26(35-24)19-7-2-15(28)12-21(19)30/h1-13H,(H,31,33)/b10-5+ |
| InChIKey | WLKWMZYKTBUOTR-BJMVGYQFSA-N |
| XLogP | 9.02 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.22 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|