C27H15Cl3FN3O3S — CID 17315618
(E)-N-[[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17315618) has the molecular formula C27H15Cl3FN3O3S and a molecular weight of 586.86 g/mol. Its IUPAC name is (E)-N-[[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17315618 |
| Molecular Formula | C27H15Cl3FN3O3S |
| Molecular Weight | 586.86 g/mol |
| Exact Mass | 584.99 |
| IUPAC Name | (E)-N-[[2-(2-chloro-4-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1ccc2oc(-c3ccc(F)cc3Cl)nc2c1 |
| InChI | InChI=1S/C27H15Cl3FN3O3S/c28-15-9-14(10-16(29)11-15)23-7-3-19(36-23)4-8-25(35)34-27(38)32-18-2-6-24-22(13-18)33-26(37-24)20-5-1-17(31)12-21(20)30/h1-13H,(H2,32,34,35,38)/b8-4+ |
| InChIKey | YTBQGCXGWLNRMG-XBXARRHUSA-N |
| XLogP | 8.38 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.86 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|