C18H12Cl2N2O2 — CID 1363914
3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-pyridin-3-ylprop-2-enamide (PubChem CID 1363914) has the molecular formula C18H12Cl2N2O2 and a molecular weight of 359.21 g/mol. Its IUPAC name is 3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-pyridin-3-ylprop-2-enamide.
| Compound Name | 3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 1363914 |
| Molecular Formula | C18H12Cl2N2O2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2Cl)o1)Nc1cccnc1 |
| InChI | InChI=1S/C18H12Cl2N2O2/c19-12-3-6-15(16(20)10-12)17-7-4-14(24-17)5-8-18(23)22-13-2-1-9-21-11-13/h1-11H,(H,22,23) |
| InChIKey | SVSUQJXXVIYJNQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|