C27H20Cl2N2O3 — CID 17117580
N-[4-[[(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-methylphenyl]benzamide (PubChem CID 17117580) has the molecular formula C27H20Cl2N2O3 and a molecular weight of 491.37 g/mol. Its IUPAC name is N-[4-[[(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-methylphenyl]benzamide.
| Compound Name | N-[4-[[(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 17117580 |
| Molecular Formula | C27H20Cl2N2O3 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[4-[[(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-methylphenyl]benzamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(-c3ccc(Cl)cc3Cl)o2)ccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H20Cl2N2O3/c1-17-15-20(8-12-24(17)31-27(33)18-5-3-2-4-6-18)30-26(32)14-10-21-9-13-25(34-21)22-11-7-19(28)16-23(22)29/h2-16H,1H3,(H,30,32)(H,31,33)/b14-10+ |
| InChIKey | OYDARPYGCZAPDD-GXDHUFHOSA-N |
| XLogP | 7.47 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|