C21H17Cl2NO4 — CID 5014101
3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(2,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 5014101) has the molecular formula C21H17Cl2NO4 and a molecular weight of 418.28 g/mol. Its IUPAC name is 3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(2,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | 3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(2,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5014101 |
| Molecular Formula | C21H17Cl2NO4 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-(2,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C=Cc2ccc(-c3ccc(Cl)cc3Cl)o2)c(OC)c1 |
| InChI | InChI=1S/C21H17Cl2NO4/c1-26-15-4-8-18(20(12-15)27-2)24-21(25)10-6-14-5-9-19(28-14)16-7-3-13(22)11-17(16)23/h3-12H,1-2H3,(H,24,25) |
| InChIKey | WHSPSOFIXHBYRT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|