C23H15Cl2N5O3S — CID 17163080
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]prop-2-enamide (PubChem CID 17163080) has the molecular formula C23H15Cl2N5O3S and a molecular weight of 512.38 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17163080 |
| Molecular Formula | C23H15Cl2N5O3S |
| Molecular Weight | 512.38 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[2-methoxy-5-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(-c2nn3cnnc3s2)cc1NC(=O)/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C23H15Cl2N5O3S/c1-32-20-7-2-13(22-29-30-12-26-28-23(30)34-22)10-18(20)27-21(31)9-5-15-4-8-19(33-15)16-6-3-14(24)11-17(16)25/h2-12H,1H3,(H,27,31)/b9-5+ |
| InChIKey | BMCDONHRPZRJKH-WEVVVXLNSA-N |
| XLogP | 6.08 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.38 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|