C23H14Cl2N6O2S2 — CID 4566625
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 4566625) has the molecular formula C23H14Cl2N6O2S2 and a molecular weight of 541.45 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4566625 |
| Molecular Formula | C23H14Cl2N6O2S2 |
| Molecular Weight | 541.45 g/mol |
| Exact Mass | 540.00 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)NC(=S)Nc1cccc(-c2nn3cnnc3s2)c1 |
| InChI | InChI=1S/C23H14Cl2N6O2S2/c24-17-6-2-5-16(20(17)25)18-9-7-15(33-18)8-10-19(32)28-22(34)27-14-4-1-3-13(11-14)21-30-31-12-26-29-23(31)35-21/h1-12H,(H2,27,28,32,34) |
| InChIKey | DTCIOEUPBXEJGS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|