C25H20Cl2N4O3S2 — CID 21170079
N-[6-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]-1,3-benzothiazol-2-yl]butanamide (PubChem CID 21170079) has the molecular formula C25H20Cl2N4O3S2 and a molecular weight of 559.50 g/mol. Its IUPAC name is N-[6-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]-1,3-benzothiazol-2-yl]butanamide.
| Compound Name | N-[6-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]-1,3-benzothiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 21170079 |
| Molecular Formula | C25H20Cl2N4O3S2 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | N-[6-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]-1,3-benzothiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nc2ccc(NC(=S)NC(=O)/C=C/c3ccc(-c4cccc(Cl)c4Cl)o3)cc2s1 |
| InChI | InChI=1S/C25H20Cl2N4O3S2/c1-2-4-21(32)31-25-29-18-10-7-14(13-20(18)36-25)28-24(35)30-22(33)12-9-15-8-11-19(34-15)16-5-3-6-17(26)23(16)27/h3,5-13H,2,4H2,1H3,(H,29,31,32)(H2,28,30,33,35)/b12-9+ |
| InChIKey | DBRXUPQRVMKAPT-FMIVXFBMSA-N |
| XLogP | 7.13 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|