C24H19Cl2N3O3S — CID 23100053
N-[6-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-1,3-benzothiazol-2-yl]butanamide (PubChem CID 23100053) has the molecular formula C24H19Cl2N3O3S and a molecular weight of 500.41 g/mol. Its IUPAC name is N-[6-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-1,3-benzothiazol-2-yl]butanamide.
| Compound Name | N-[6-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-1,3-benzothiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 23100053 |
| Molecular Formula | C24H19Cl2N3O3S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | N-[6-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-1,3-benzothiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nc2ccc(NC(=O)/C=C/c3ccc(-c4cc(Cl)cc(Cl)c4)o3)cc2s1 |
| InChI | InChI=1S/C24H19Cl2N3O3S/c1-2-3-22(30)29-24-28-19-7-4-17(13-21(19)33-24)27-23(31)9-6-18-5-8-20(32-18)14-10-15(25)12-16(26)11-14/h4-13H,2-3H2,1H3,(H,27,31)(H,28,29,30)/b9-6+ |
| InChIKey | XGASPZMASDLKFY-RMKNXTFCSA-N |
| XLogP | 7.25 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|