C20H13ClN2O2S — CID 17098475
(E)-N-(6-chloro-1,3-benzothiazol-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enamide (PubChem CID 17098475) has the molecular formula C20H13ClN2O2S and a molecular weight of 380.86 g/mol. Its IUPAC name is (E)-N-(6-chloro-1,3-benzothiazol-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(6-chloro-1,3-benzothiazol-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17098475 |
| Molecular Formula | C20H13ClN2O2S |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (E)-N-(6-chloro-1,3-benzothiazol-2-yl)-3-(5-phenylfuran-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)o1)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C20H13ClN2O2S/c21-14-6-9-16-18(12-14)26-20(22-16)23-19(24)11-8-15-7-10-17(25-15)13-4-2-1-3-5-13/h1-12H,(H,22,23,24)/b11-8+ |
| InChIKey | DIPIUIXTRMCIGC-DHZHZOJOSA-N |
| XLogP | 5.86 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|