C20H11Cl2FN2O2S — CID 4670080
3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 4670080) has the molecular formula C20H11Cl2FN2O2S and a molecular weight of 433.29 g/mol. Its IUPAC name is 3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4670080 |
| Molecular Formula | C20H11Cl2FN2O2S |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | 3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cc(Cl)cc(Cl)c2)o1)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C20H11Cl2FN2O2S/c21-12-7-11(8-13(22)9-12)17-5-2-15(27-17)3-6-19(26)25-20-24-16-4-1-14(23)10-18(16)28-20/h1-10H,(H,24,25,26) |
| InChIKey | PORZPOGTUFXWGZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|