C20H10Cl4N2O2S — CID 17117031
(E)-N-(4,5-dichloro-1,3-benzothiazol-2-yl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17117031) has the molecular formula C20H10Cl4N2O2S and a molecular weight of 484.19 g/mol. Its IUPAC name is (E)-N-(4,5-dichloro-1,3-benzothiazol-2-yl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(4,5-dichloro-1,3-benzothiazol-2-yl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17117031 |
| Molecular Formula | C20H10Cl4N2O2S |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 481.92 |
| IUPAC Name | (E)-N-(4,5-dichloro-1,3-benzothiazol-2-yl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)Nc1nc2c(Cl)c(Cl)ccc2s1 |
| InChI | InChI=1S/C20H10Cl4N2O2S/c21-11-7-10(8-12(22)9-11)15-4-1-13(28-15)2-6-17(27)25-20-26-19-16(29-20)5-3-14(23)18(19)24/h1-9H,(H,25,26,27)/b6-2+ |
| InChIKey | PKHSWBNNDTUMHH-QHHAFSJGSA-N |
| XLogP | 7.82 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|