C19H11Cl3N2O4 — CID 22780766
(E)-N-(2-chloro-5-nitrophenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 22780766) has the molecular formula C19H11Cl3N2O4 and a molecular weight of 437.67 g/mol. Its IUPAC name is (E)-N-(2-chloro-5-nitrophenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-chloro-5-nitrophenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 22780766 |
| Molecular Formula | C19H11Cl3N2O4 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | (E)-N-(2-chloro-5-nitrophenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H11Cl3N2O4/c20-12-7-11(8-13(21)9-12)18-5-2-15(28-18)3-6-19(25)23-17-10-14(24(26)27)1-4-16(17)22/h1-10H,(H,23,25)/b6-3+ |
| InChIKey | MTEDAPPJWZUYLH-ZZXKWVIFSA-N |
| XLogP | 6.47 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|