C20H12Cl2FN3O4S — CID 17114381
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(4-fluoro-3-nitrophenyl)carbamothioyl]prop-2-enamide (PubChem CID 17114381) has the molecular formula C20H12Cl2FN3O4S and a molecular weight of 480.30 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(4-fluoro-3-nitrophenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(4-fluoro-3-nitrophenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17114381 |
| Molecular Formula | C20H12Cl2FN3O4S |
| Molecular Weight | 480.30 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(4-fluoro-3-nitrophenyl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H12Cl2FN3O4S/c21-12-7-11(8-13(22)9-12)18-5-2-15(30-18)3-6-19(27)25-20(31)24-14-1-4-16(23)17(10-14)26(28)29/h1-10H,(H2,24,25,27,31)/b6-3+ |
| InChIKey | BSHHSZSDHIODHW-ZZXKWVIFSA-N |
| XLogP | 5.83 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.30 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|