C23H19Cl2N3O3S — CID 17114339
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[3-(propanoylamino)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17114339) has the molecular formula C23H19Cl2N3O3S and a molecular weight of 488.40 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[3-(propanoylamino)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[3-(propanoylamino)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17114339 |
| Molecular Formula | C23H19Cl2N3O3S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[3-(propanoylamino)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CCC(=O)Nc1cccc(NC(=S)NC(=O)/C=C/c2ccc(-c3cc(Cl)cc(Cl)c3)o2)c1 |
| InChI | InChI=1S/C23H19Cl2N3O3S/c1-2-21(29)26-17-4-3-5-18(13-17)27-23(32)28-22(30)9-7-19-6-8-20(31-19)14-10-15(24)12-16(25)11-14/h3-13H,2H2,1H3,(H,26,29)(H2,27,28,30,32)/b9-7+ |
| InChIKey | MUKQCWRLJCWMLA-VQHVLOKHSA-N |
| XLogP | 6.13 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|