C29H19Cl2N3O4S — CID 17315804
N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 17315804) has the molecular formula C29H19Cl2N3O4S and a molecular weight of 576.46 g/mol. Its IUPAC name is N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17315804 |
| Molecular Formula | C29H19Cl2N3O4S |
| Molecular Weight | 576.46 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1cccc(NC(=O)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C29H19Cl2N3O4S/c30-19-12-18(13-20(31)15-19)25-10-8-23(37-25)9-11-27(35)34-29(39)33-22-6-3-5-21(16-22)32-28(36)26-14-17-4-1-2-7-24(17)38-26/h1-16H,(H,32,36)(H2,33,34,35,39)/b11-9+ |
| InChIKey | WJQXUDXMNXMMTI-PKNBQFBNSA-N |
| XLogP | 7.78 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.46 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|