C26H17Cl3N2O3 — CID 17117694
2-chloro-N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]benzamide (PubChem CID 17117694) has the molecular formula C26H17Cl3N2O3 and a molecular weight of 511.79 g/mol. Its IUPAC name is 2-chloro-N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 17117694 |
| Molecular Formula | C26H17Cl3N2O3 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | 2-chloro-N-[3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)Nc1cccc(NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C26H17Cl3N2O3/c27-17-12-16(13-18(28)14-17)24-10-8-21(34-24)9-11-25(32)30-19-4-3-5-20(15-19)31-26(33)22-6-1-2-7-23(22)29/h1-15H,(H,30,32)(H,31,33)/b11-9+ |
| InChIKey | GGIOKRRWCKPYJJ-PKNBQFBNSA-N |
| XLogP | 7.81 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|