C20H13Cl2NO4 — CID 28686539
4-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoic acid (PubChem CID 28686539) has the molecular formula C20H13Cl2NO4 and a molecular weight of 402.23 g/mol. Its IUPAC name is 4-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 28686539 |
| Molecular Formula | C20H13Cl2NO4 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 4-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H13Cl2NO4/c21-14-9-13(10-15(22)11-14)18-7-5-17(27-18)6-8-19(24)23-16-3-1-12(2-4-16)20(25)26/h1-11H,(H,23,24)(H,25,26)/b8-6+ |
| InChIKey | NVUCVGIZURWTPO-SOFGYWHQSA-N |
| XLogP | 5.60 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|