C23H17Cl2NO6 — CID 17117500
dimethyl 5-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 17117500) has the molecular formula C23H17Cl2NO6 and a molecular weight of 474.30 g/mol. Its IUPAC name is dimethyl 5-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 17117500 |
| Molecular Formula | C23H17Cl2NO6 |
| Molecular Weight | 474.30 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | dimethyl 5-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)/C=C/c2ccc(-c3cc(Cl)cc(Cl)c3)o2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H17Cl2NO6/c1-30-22(28)14-7-15(23(29)31-2)11-18(10-14)26-21(27)6-4-19-3-5-20(32-19)13-8-16(24)12-17(25)9-13/h3-12H,1-2H3,(H,26,27)/b6-4+ |
| InChIKey | INBHVQLZORYKMR-GQCTYLIASA-N |
| XLogP | 5.48 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.30 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|