C22H17Cl2NO4 — CID 17066448
ethyl 3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate (PubChem CID 17066448) has the molecular formula C22H17Cl2NO4 and a molecular weight of 430.29 g/mol. Its IUPAC name is ethyl 3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 17066448 |
| Molecular Formula | C22H17Cl2NO4 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | ethyl 3-[[(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)/C=C/c2ccc(-c3cc(Cl)cc(Cl)c3)o2)c1 |
| InChI | InChI=1S/C22H17Cl2NO4/c1-2-28-22(27)14-4-3-5-18(12-14)25-21(26)9-7-19-6-8-20(29-19)15-10-16(23)13-17(24)11-15/h3-13H,2H2,1H3,(H,25,26)/b9-7+ |
| InChIKey | ZGTKOOYRLISTRN-VQHVLOKHSA-N |
| XLogP | 6.08 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|