C29H23NO5 — CID 4736135
ethyl 4-[5-[3-(3-benzamidophenyl)-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 4736135) has the molecular formula C29H23NO5 and a molecular weight of 465.51 g/mol. Its IUPAC name is ethyl 4-[5-[3-(3-benzamidophenyl)-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[3-(3-benzamidophenyl)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4736135 |
| Molecular Formula | C29H23NO5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | ethyl 4-[5-[3-(3-benzamidophenyl)-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=CC(=O)c3cccc(NC(=O)c4ccccc4)c3)o2)cc1 |
| InChI | InChI=1S/C29H23NO5/c1-2-34-29(33)22-13-11-20(12-14-22)27-18-16-25(35-27)15-17-26(31)23-9-6-10-24(19-23)30-28(32)21-7-4-3-5-8-21/h3-19H,2H2,1H3,(H,30,32) |
| InChIKey | YGSDWNDDTXMHHV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|