C26H20N4O4 — CID 1491630
ethyl 4-[5-[(2-phenylbenzotriazol-5-yl)carbamoyl]furan-2-yl]benzoate (PubChem CID 1491630) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is ethyl 4-[5-[(2-phenylbenzotriazol-5-yl)carbamoyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(2-phenylbenzotriazol-5-yl)carbamoyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 1491630 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | ethyl 4-[5-[(2-phenylbenzotriazol-5-yl)carbamoyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C(=O)Nc3ccc4nn(-c5ccccc5)nc4c3)o2)cc1 |
| InChI | InChI=1S/C26H20N4O4/c1-2-33-26(32)18-10-8-17(9-11-18)23-14-15-24(34-23)25(31)27-19-12-13-21-22(16-19)29-30(28-21)20-6-4-3-5-7-20/h3-16H,2H2,1H3,(H,27,31) |
| InChIKey | LHFWQZUFTYWERG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |