C27H18F3NO3 — CID 4736164
N-[3-[3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]phenyl]benzamide (PubChem CID 4736164) has the molecular formula C27H18F3NO3 and a molecular weight of 461.44 g/mol. Its IUPAC name is N-[3-[3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]phenyl]benzamide.
| Compound Name | N-[3-[3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4736164 |
| Molecular Formula | C27H18F3NO3 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-[3-[3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoyl]phenyl]benzamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H18F3NO3/c28-27(29,30)21-10-4-9-20(16-21)25-15-13-23(34-25)12-14-24(32)19-8-5-11-22(17-19)31-26(33)18-6-2-1-3-7-18/h1-17H,(H,31,33) |
| InChIKey | NPFXADURPBQVRD-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|