C22H17F3O2 — CID 6287121
(E)-1-(4-ethylphenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one (PubChem CID 6287121) has the molecular formula C22H17F3O2 and a molecular weight of 370.37 g/mol. Its IUPAC name is (E)-1-(4-ethylphenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-ethylphenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6287121 |
| Molecular Formula | C22H17F3O2 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (E)-1-(4-ethylphenyl)-3-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-en-1-one |
| SMILES | CCc1ccc(C(=O)/C=C/c2ccc(-c3cccc(C(F)(F)F)c3)o2)cc1 |
| InChI | InChI=1S/C22H17F3O2/c1-2-15-6-8-16(9-7-15)20(26)12-10-19-11-13-21(27-19)17-4-3-5-18(14-17)22(23,24)25/h3-14H,2H2,1H3/b12-10+ |
| InChIKey | GMZSMUYHWIUKNS-ZRDIBKRKSA-N |
| XLogP | 6.42 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|