C17H12F6O3 — CID 87239785
ethyl (E)-3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoate (PubChem CID 87239785) has the molecular formula C17H12F6O3 and a molecular weight of 378.27 g/mol. Its IUPAC name is ethyl (E)-3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 87239785 |
| Molecular Formula | C17H12F6O3 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | ethyl (E)-3-[5-[3,5-bis(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C17H12F6O3/c1-2-25-15(24)6-4-13-3-5-14(26-13)10-7-11(16(18,19)20)9-12(8-10)17(21,22)23/h3-9H,2H2,1H3/b6-4+ |
| InChIKey | OLSSHKJOJCMKFV-GQCTYLIASA-N |
| XLogP | 5.56 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|