C15H11Cl3O3 — CID 53441856
ethyl 3-[5-(2,4,6-trichlorophenyl)furan-2-yl]prop-2-enoate (PubChem CID 53441856) has the molecular formula C15H11Cl3O3 and a molecular weight of 345.61 g/mol. Its IUPAC name is ethyl 3-[5-(2,4,6-trichlorophenyl)furan-2-yl]prop-2-enoate.
| Compound Name | ethyl 3-[5-(2,4,6-trichlorophenyl)furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 53441856 |
| Molecular Formula | C15H11Cl3O3 |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | ethyl 3-[5-(2,4,6-trichlorophenyl)furan-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(-c2c(Cl)cc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C15H11Cl3O3/c1-2-20-14(19)6-4-10-3-5-13(21-10)15-11(17)7-9(16)8-12(15)18/h3-8H,2H2,1H3 |
| InChIKey | CVDOVZYGFLWVNV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|