C13H9Cl2NO2 — CID 28665530
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 28665530) has the molecular formula C13H9Cl2NO2 and a molecular weight of 282.13 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 28665530 |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C13H9Cl2NO2/c14-9-5-8(6-10(15)7-9)12-3-1-11(18-12)2-4-13(16)17/h1-7H,(H2,16,17)/b4-2+ |
| InChIKey | OOCDBPCZWQPKJV-DUXPYHPUSA-N |
| XLogP | 3.75 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|