C19H12BrCl2NO2 — CID 22780629
(E)-N-(2-bromophenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 22780629) has the molecular formula C19H12BrCl2NO2 and a molecular weight of 437.12 g/mol. Its IUPAC name is (E)-N-(2-bromophenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(2-bromophenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 22780629 |
| Molecular Formula | C19H12BrCl2NO2 |
| Molecular Weight | 437.12 g/mol |
| Exact Mass | 434.94 |
| IUPAC Name | (E)-N-(2-bromophenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)Nc1ccccc1Br |
| InChI | InChI=1S/C19H12BrCl2NO2/c20-16-3-1-2-4-17(16)23-19(24)8-6-15-5-7-18(25-15)12-9-13(21)11-14(22)10-12/h1-11H,(H,23,24)/b8-6+ |
| InChIKey | RZPVTQOOWRASGG-SOFGYWHQSA-N |
| XLogP | 6.67 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.12 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|