C20H13Cl2F2NO3 — CID 22778031
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[2-(difluoromethoxy)phenyl]prop-2-enamide (PubChem CID 22778031) has the molecular formula C20H13Cl2F2NO3 and a molecular weight of 424.23 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[2-(difluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[2-(difluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 22778031 |
| Molecular Formula | C20H13Cl2F2NO3 |
| Molecular Weight | 424.23 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[2-(difluoromethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C20H13Cl2F2NO3/c21-13-9-12(10-14(22)11-13)17-7-5-15(27-17)6-8-19(26)25-16-3-1-2-4-18(16)28-20(23)24/h1-11,20H,(H,25,26)/b8-6+ |
| InChIKey | XHKBVFUGXDVYTK-SOFGYWHQSA-N |
| XLogP | 6.51 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.23 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|