C27H16ClNO4 — CID 3989405
3-[5-(4-chlorophenyl)furan-2-yl]-N-(9,10-dioxoanthracen-1-yl)prop-2-enamide (PubChem CID 3989405) has the molecular formula C27H16ClNO4 and a molecular weight of 453.88 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-N-(9,10-dioxoanthracen-1-yl)prop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-(9,10-dioxoanthracen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3989405 |
| Molecular Formula | C27H16ClNO4 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-(9,10-dioxoanthracen-1-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2)o1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H16ClNO4/c28-17-10-8-16(9-11-17)23-14-12-18(33-23)13-15-24(30)29-22-7-3-6-21-25(22)27(32)20-5-2-1-4-19(20)26(21)31/h1-15H,(H,29,30) |
| InChIKey | HLENAPFBOFJAHW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|