C22H20ClNO2 — CID 3988299
3-[5-(4-chlorophenyl)furan-2-yl]-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 3988299) has the molecular formula C22H20ClNO2 and a molecular weight of 365.86 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3988299 |
| Molecular Formula | C22H20ClNO2 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)C=Cc2ccc(-c3ccc(Cl)cc3)o2)c(C)c1 |
| InChI | InChI=1S/C22H20ClNO2/c1-14-12-15(2)22(16(3)13-14)24-21(25)11-9-19-8-10-20(26-19)17-4-6-18(23)7-5-17/h4-13H,1-3H3,(H,24,25) |
| InChIKey | IRFKYZHQXKSLNT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|