C22H19BrClNO2 — CID 22781754
(E)-N-(4-bromo-2,6-dimethylphenyl)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 22781754) has the molecular formula C22H19BrClNO2 and a molecular weight of 444.76 g/mol. Its IUPAC name is (E)-N-(4-bromo-2,6-dimethylphenyl)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(4-bromo-2,6-dimethylphenyl)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 22781754 |
| Molecular Formula | C22H19BrClNO2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | (E)-N-(4-bromo-2,6-dimethylphenyl)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)Nc3c(C)cc(Br)cc3C)o2)cc1Cl |
| InChI | InChI=1S/C22H19BrClNO2/c1-13-4-5-16(12-19(13)24)20-8-6-18(27-20)7-9-21(26)25-22-14(2)10-17(23)11-15(22)3/h4-12H,1-3H3,(H,25,26)/b9-7+ |
| InChIKey | YZWWHDQUOVUFRI-VQHVLOKHSA-N |
| XLogP | 6.94 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|